What is the name of C6H16N2?

Hexanediamine
Hexanediamine | C6H16N2 – PubChem.

What is the name of C3H7COO?

Sodium butyrate is a compound with formula Na(C3H7COO). It is the sodium salt of butyric acid.

What is the name of C7H6?

Dehydrotoluene | C7H6 – PubChem.

What is the empirical formula for C6H16N2?

Identification of 1,6-Hexanediamine Chemical Compound

Chemical Formula	C6H16N2
IUPAC Name	hexane-1,6-diamine
SMILES String	NCCCCCCN
InChI	InChI=1S/C6H16N2/c7-5-3-1-2-4-6-8/h1-8H2
InChIKey	NAQMVNRVTILPCV-UHFFFAOYSA-N

How do you make hexamethylenediamine?

Hexamethylenediamine was first reported by Theodor Curtius. It is produced by the hydrogenation of adiponitrile: NC(CH2)4CN + 4 H2 → H2N(CH2)6NH. The hydrogenation is conducted on molten adiponitrile diluted with ammonia, typical catalysts being based on cobalt and iron.

What is the IUPAC name of acetamide?

IUPAC Name	acetamide
Alternative Names	acetamide Ethanamide Acetic acid amide Methanecarboxamide Acetimidic acid
Molecular Formula	C2H5NO
Molar Mass	59.068 g/mol
InChI	InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)

What is the structural formula of Ethanamide?

C2H5NOAcetamide / Formula

Acetamide Formula and Structure The chemical formula of acetamide is C2H5NO or CH3CONH2. Moreover, its molar mass is 59.07 g/mol.

What is the name of the compound C7H16?

Heptane or n-heptane is the straight-chain alkane with the chemical formula H3C(CH2)5CH3 or C7H16, and is one of the main components of gasoline (petrol).

What is the molar mass of C7H16?

100.21 g/moln-Heptane / Molar mass

How is hexamethylenediamine formed?

What is acetamide chemical formula?

C2H5NOAcetamide / Formula

What is the functional group of acetamide?

carboxylic acid amide functional group
Acetamide Formula and Structure The acetamide has a methyl group (-CH3) bound to a carbonyl (CO) and Amine (NH2). Besides, the acetamide primarily comprises of carboxylic acid amide functional group that has a general structure RC (=O) NH2.