What is example of adipic acid?
Nearly all commercial adipic acid is produced from cyclohexane. Almost 90 percent of adipic acid produced is used in the production of nylon 66. The nylon, which has a protein-like structure, is further processed into fibers for applications in carpeting, automobile tire cord, and clothing.
What is the function of pimelic acid?
Pimelic acid is an alpha,omega-dicarboxylic acid that is pentane with two carboxylic acid groups at positions C-1 and C-5. It has a role as an Escherichia coli metabolite and a Daphnia magna metabolite. It is an alpha,omega-dicarboxylic acid and a lipid. It is a conjugate acid of a pimelate and a pimelate(1-).
How adipic acid is formed?
Adipic acid is produced from a mixture of cyclohexanone and cyclohexanol called KA oil, the abbreviation of ketone-alcohol oil. The KA oil is oxidized with nitric acid to give adipic acid, via a multistep pathway.
What is the structural formula of pimelic acid?
C7H12O4
Pimelic acid/Formula
Who first created adipic acid?
Dieterle
Figure 27. Adipic acid. Adipic acid was first obtained by Dieterle and his colleagues in 1884 by oxidation of castor oil with nitric acid.
What is the symbol of adipic acid?
C₆H₁₀O₄
Adipic acid/Formula
What is the source of pimelic acid?
Pimelic acid has been synthesized from cyclohexanone and from salicylic acid. In the former route, the additional carbon is supplied by dimethyloxalate, which reacts with the enolate.
What is the Iupac name of pimelic acid?
heptanedioic acid
| IUPAC Name | heptanedioic acid |
|---|---|
| Alternative Names | pimelic acid Heptanedioic acid 1,5-Pentanedicarboxylic acid Heptandioic acid pimelate Heptane-1,7-dioic acid |
| Molecular Formula | C7H12O4 |
| Molar Mass | 160.169 g/mol |
| InChI | InChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11) |
Who makes adipic acid?
Ascend is the only large-scale producer of food-grade adipic acid in the world.
Which catalyst is used in adipic acid synthesis?
Traditional feedstock for the synthesis of adipic acid is benzene. Benzene is hydrogenated using Ni-Al2O3 catalyst at 370–800 psi to cyclohexane. This is oxidized using Co catalyst to a mixture of cyclohexanone and cyclohexanol.
What is Iupac name of adipic acid?
hexanedioic acid
Adipic acid/IUPAC ID
What is the general formula for pimelic acid?
Pimelic acid is a group of compounds that are derivatives of heptanedioic acid with the general formula R-C7H11O4. Pimelic acid is the organic compound with the formula HO2C(CH2)5CO2H. Derivatives of pimelic acid are involved in the biosynthesis of the amino acid called lysine.
How do adipic acid and pimelic acid pyrolyze?
Adipic acid (hexanedioic acid) and pimelic acid (heptanedioic acid) pyrolyze differently from the acids with a smaller number of carbon atoms. The typical reaction for these acids is the elimination of H2 O and CO 2 with the formation of a ketone by the following reaction:
What is pimelic acid used for?
Pimelic acid is an alpha,omega-dicarboxylic acid that is pentane with two carboxylic acid groups at positions C-1 and C-5. It has a role as an Escherichia coli metabolite and a Daphnia magna metabolite. It is a conjugate acid of a
What is the biosynthesis of pimelic acid?
The biosynthesis of pimelic acid is unknown but is speculated to start with malonyl CoA. Like other simple dicarboxylic acids, many methods have been developed for producing pimelic acid. Pimelic acid is produced commercially by oxidation of cycloheptanone with dinitrogen tetroxide.