What is cyclohexyl acetate used for?
Cyclohexyl Acetate is a colorless, oily liquid with a fruity odor. It is used as a solvent and as a synthetic flavor in food.
Is cyclohexyl acetate soluble in water?
Online Edition: “Specifications for Flavourings”
| Flavouring | Cyclohexyl acetate |
|---|---|
| Molecular weight | 142.19 |
| Chemical formula | C8H14O2 |
| Physical form/odour | Oily liquid; odour reminiscent of amyl acetate |
| Solubility | Insoluble in water; miscible in ether |
Is cyclohexyl acetate an ester?
Cyclohexyl acetate is a carboxylic ester.
What is the empirical formula for C8H14O2?
Identification of CYCLOHEXYL ACETATE Chemical Compound
| Chemical Formula | C8H14O2 |
|---|---|
| Molecular Weight | 142.19556 g/mol |
| IUPAC Name | cyclohexyl acetate |
| SMILES String | CC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C8H14O2/c1-7(9)10-8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
What is the structure of cyclohexylamine?
Cyclohexylamine
| PubChem CID | 7965 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H13N or C6H11NH2 |
| Synonyms | CYCLOHEXYLAMINE Cyclohexanamine 108-91-8 Aminocyclohexane Hexahydroaniline More… |
What is the structure of Cyclohexylmethanol?
Cyclohexylmethanol is an organic compound with the formula C 6H 11−CH 2−OH. It is a cyclohexane ring functionalized with an alcohol, specifically a hydroxymethyl group.
What is the boiling point of cyclohexanol?
323.3°F (161.8°C)
Cyclohexanol/Boiling point
Why is cyclohexylamine toxic?
The corrosive effect of cyclohexylamine is due to its alkalinity; sympathomimetic and cardiovascular effects have been described for it (Barger and Dal 1910). In addition, it releases catecholamine and histamine (Miyata et al. 1969).
Is cyclohexylamine volatile?
Cyclohexylamine strongly prefers the steam phase while morpholine has a relatively volatility close to that of water. Thus, common reagents used are amines such as ammonia, morpholine, and cyclohexylamine.
What type of alcohol is Cyclohexylmethanol?
Cyclohexylmethanol is an organic compound with the formula C 6H 11−CH 2−OH. It is a cyclohexane ring functionalized with an alcohol, specifically a hydroxymethyl group. The compound is a colorless liquid, although commercial samples can appear yellow….Cyclohexylmethanol.
| Names | |
|---|---|
| show InChI | |
| show SMILES | |
| Properties | |
| Chemical formula | C7H14O |